Boronic acid derivatives
Aobchem 4-Chloro-3-nitrophenylboronic acid | 97% | CAS 151169-67-4 | C6H5BClNO4 | 500g
4-Chloro-3-nitrophenylboronic acid | 97% | CAS 151169-67-4 | C6H5BClNO4 | 500g
Aobchem 3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 1g
3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 1g
Aobchem 3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 5g
3-Bromo-4-carboxyphenylboronic acid | 97% | CAS 3066919-53-4 | C7H6BBrO4 | 5g
Aobchem 3-Bromo-5-butoxyphenylboronic acid pinacol ester | ≥97% | CAS 1218790-35-2 | C16H24BBrO3 | 10g
3-Bromo-5-butoxyphenylboronic acid pinacol ester | ≥97% | CAS 1218790-35-2 | C16H24BBrO3 | 10g
eMolecules 5720-06-9 | 2-Methoxyphenylboronic acid | AA Blocks LLC | MFCD00236047 | 151.960 | C7H9BO3 | 0.000 | COc1ccccc1B(O)O | 25g | 410175681
2-Methoxyphenylboronic acid | AA Blocks LLC | 5720-06-9 | MFCD00236047 | 151.960 | C7H9BO3 | 0.000 | COc1ccccc1B(O)O | 25g | 410175681
Aobchem 3-Acetyl-4-fluorophenylboronic acid | ≥97% | CAS 850198-68-4 | C8H8BFO3 | 25g
3-Acetyl-4-fluorophenylboronic acid | ≥97% | CAS 850198-68-4 | C8H8BFO3 | 25g
Aobchem 4-Amino-3-nitrophenylboronic acid pinacol ester | ≥97% | CAS 833486-94-5 | C12H17BN2O4 | 10g
4-Amino-3-nitrophenylboronic acid pinacol ester | ≥97% | CAS 833486-94-5 | C12H17BN2O4 | 10g
Aobchem 2-(2 2 2-Trifluoroethoxy)-6-(trifluoromethyl)-3-pyridinecarboxylic acid | ≥97% | CAS 1505575-72-3 | C9H5F6NO3 | 250mg
2-(2 2 2-Trifluoroethoxy)-6-(trifluoromethyl)-3-pyridinecarboxylic acid | ≥97% | CAS 1505575-72-3 | C9H5F6NO3 | 250mg
Aobchem 2 5-Dimethoxyphenylboronic acid | 97% | CAS 107099-99-0 | C8H11BO4 | 500g
2 5-Dimethoxyphenylboronic acid | 97% | CAS 107099-99-0 | C8H11BO4 | 500g
eMolecules 1806353-99-0 | (2,6-DICHLORO-4-FLUOROPHENYL)METHANOL | MFCD28133674 | 1g
Ambeed | (S)-4-(tert-Butyl)-2-(5678-tetrahydroquinolin-2-yl)-45-dihydrooxazole | 100mg | 633660836 | A1462410 | 2757082-78-1 | 258.365 | C16H22N2O
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
Aobchem 3 4-Bis(2 2 2-trifluoroethoxy)benzoic acid | 95% | CAS 35480-54-7 | C11H8F6O4 | 5g
3 4-Bis(2 2 2-trifluoroethoxy)benzoic acid | 95% | CAS 35480-54-7 | C11H8F6O4 | 5g
Medchemexpress LLC Boronic acid, B-(3-aminophenyl)- | 30418-59-8 | MFCD00007755 | 99.9% | 136.94 g/mol | C6H8BNO2 | 10 G
3-Aminophenylboronic acid is an organoboron reagent and building block used in organic synthesis and biochemical research. It is supplied as a solid of high purity and is commonly used to functionalize nanomaterials, such as copper nanoclusters, enabling rapid, selective detection of glycoproteins.
- Chemical formula: C6H8BNO2.
- Molecular weight: 136.94 g/mol.
- CAS number: 30418-59-8.
- Purity: 99.87%.
- Physical form: solid.
- Applications include biochemical assays and organic synthesis.
- Available in research pack sizes including 10 g.
Aobchem 4-Carboxyphenylboronic acid ethylene glycol ester | ≥97% | CAS 276694-12-3 | C9H9BO4 | 10g
4-Carboxyphenylboronic acid ethylene glycol ester | ≥97% | CAS 276694-12-3 | C9H9BO4 | 10g
eMolecules 819057-45-9 | (4-AMINO-2-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | MFCD09951877 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1F | 1g | 248473840
(4-AMINO-2-FLUOROPHENYL)BORONIC ACID PINACOL ESTER | AstaTech | 819057-45-9 | MFCD09951877 | 237.080 | C12H17BFNO2 | 95.000 | CC1(C)OB(OC1(C)C)c1ccc(N)cc1F | 1g | 248473840